C23H20N4O4S2 — CID 59797922
N'-(4-methylphenyl)sulfonyl-3-oxo-5-(4-phenoxyanilino)-1,2-thiazole-4-carboximidamide (PubChem CID 59797922) has the molecular formula C23H20N4O4S2 and a molecular weight of 480.57 g/mol. Its IUPAC name is N'-(4-methylphenyl)sulfonyl-3-oxo-5-(4-phenoxyanilino)-1,2-thiazole-4-carboximidamide.
| Compound Name | N'-(4-methylphenyl)sulfonyl-3-oxo-5-(4-phenoxyanilino)-1,2-thiazole-4-carboximidamide |
|---|---|
| PubChem CID | 59797922 |
| Molecular Formula | C23H20N4O4S2 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | N'-(4-methylphenyl)sulfonyl-3-oxo-5-(4-phenoxyanilino)-1,2-thiazole-4-carboximidamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=C(\N)c2c(Nc3ccc(Oc4ccccc4)cc3)s[nH]c2=O)cc1 |
| InChI | InChI=1S/C23H20N4O4S2/c1-15-7-13-19(14-8-15)33(29,30)27-21(24)20-22(28)26-32-23(20)25-16-9-11-18(12-10-16)31-17-5-3-2-4-6-17/h2-14,25H,1H3,(H2,24,27)(H,26,28) |
| InChIKey | YBADRHLBFACMOP-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|