C19H18ClFN4O2S — CID 59797946
5-[4-(2-chloro-4-fluorophenoxy)anilino]-3-oxo-N'-propan-2-yl-1,2-thiazole-4-carboximidamide (PubChem CID 59797946) has the molecular formula C19H18ClFN4O2S and a molecular weight of 420.90 g/mol. Its IUPAC name is 5-[4-(2-chloro-4-fluorophenoxy)anilino]-3-oxo-N'-propan-2-yl-1,2-thiazole-4-carboximidamide.
| Compound Name | 5-[4-(2-chloro-4-fluorophenoxy)anilino]-3-oxo-N'-propan-2-yl-1,2-thiazole-4-carboximidamide |
|---|---|
| PubChem CID | 59797946 |
| Molecular Formula | C19H18ClFN4O2S |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 5-[4-(2-chloro-4-fluorophenoxy)anilino]-3-oxo-N'-propan-2-yl-1,2-thiazole-4-carboximidamide |
| SMILES | CC(C)/N=C(\N)c1c(Nc2ccc(Oc3ccc(F)cc3Cl)cc2)s[nH]c1=O |
| InChI | InChI=1S/C19H18ClFN4O2S/c1-10(2)23-17(22)16-18(26)25-28-19(16)24-12-4-6-13(7-5-12)27-15-8-3-11(21)9-14(15)20/h3-10,24H,1-2H3,(H2,22,23)(H,25,26) |
| InChIKey | OHFDOIZMTMGYTQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|