C41H34IrN2OP- — CID 59800382
(2-hydroxy-5-methylphenyl)-diphenylphosphanium;iridium;bis(2-phenylpyridine) (PubChem CID 59800382) has the molecular formula C41H34IrN2OP- and a molecular weight of 793.93 g/mol. Its IUPAC name is (2-hydroxy-5-methylphenyl)-diphenylphosphanium;iridium;bis(2-phenylpyridine).
| Compound Name | (2-hydroxy-5-methylphenyl)-diphenylphosphanium;iridium;bis(2-phenylpyridine) |
|---|---|
| PubChem CID | 59800382 |
| Molecular Formula | C41H34IrN2OP- |
| Molecular Weight | 793.93 g/mol |
| Exact Mass | 794.20 |
| IUPAC Name | (2-hydroxy-5-methylphenyl)-diphenylphosphanium;iridium;bis(2-phenylpyridine) |
| SMILES | Cc1ccc(O)c([PH+](c2ccccc2)c2ccccc2)c1.[Ir].[c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C19H17OP.2C11H8N.Ir/c1-15-12-13-18(20)19(14-15)21(16-8-4-2-5-9-16)17-10-6-3-7-11-17;2*1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h2-14,20H,1H3;2*1-6,8-9H;/q;2*-1;/p+1 |
| InChIKey | OTGKVZNKEXPYFV-UHFFFAOYSA-O |
| XLogP | 8.29 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.93 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|