C24H19F3N2O2 — CID 59804527
3-(2-ethylphenyl)-N-[4-(trifluoromethoxy)phenyl]indole-1-carboxamide (PubChem CID 59804527) has the molecular formula C24H19F3N2O2 and a molecular weight of 424.42 g/mol. Its IUPAC name is 3-(2-ethylphenyl)-N-[4-(trifluoromethoxy)phenyl]indole-1-carboxamide.
| Compound Name | 3-(2-ethylphenyl)-N-[4-(trifluoromethoxy)phenyl]indole-1-carboxamide |
|---|---|
| PubChem CID | 59804527 |
| Molecular Formula | C24H19F3N2O2 |
| Molecular Weight | 424.42 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 3-(2-ethylphenyl)-N-[4-(trifluoromethoxy)phenyl]indole-1-carboxamide |
| SMILES | CCc1ccccc1-c1cn(C(=O)Nc2ccc(OC(F)(F)F)cc2)c2ccccc12 |
| InChI | InChI=1S/C24H19F3N2O2/c1-2-16-7-3-4-8-19(16)21-15-29(22-10-6-5-9-20(21)22)23(30)28-17-11-13-18(14-12-17)31-24(25,26)27/h3-15H,2H2,1H3,(H,28,30) |
| InChIKey | CWJJUZHDWFBANH-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.42 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |