C24H17F3N2O3 — CID 25109396
3-(2-acetylphenyl)-N-[4-(trifluoromethoxy)phenyl]indole-1-carboxamide (PubChem CID 25109396) has the molecular formula C24H17F3N2O3 and a molecular weight of 438.41 g/mol. Its IUPAC name is 3-(2-acetylphenyl)-N-[4-(trifluoromethoxy)phenyl]indole-1-carboxamide.
| Compound Name | 3-(2-acetylphenyl)-N-[4-(trifluoromethoxy)phenyl]indole-1-carboxamide |
|---|---|
| PubChem CID | 25109396 |
| Molecular Formula | C24H17F3N2O3 |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 3-(2-acetylphenyl)-N-[4-(trifluoromethoxy)phenyl]indole-1-carboxamide |
| SMILES | CC(=O)c1ccccc1-c1cn(C(=O)Nc2ccc(OC(F)(F)F)cc2)c2ccccc12 |
| InChI | InChI=1S/C24H17F3N2O3/c1-15(30)18-6-2-3-7-19(18)21-14-29(22-9-5-4-8-20(21)22)23(31)28-16-10-12-17(13-11-16)32-24(25,26)27/h2-14H,1H3,(H,28,31) |
| InChIKey | RNCRMBKWSOSTKB-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |