C23H14F6N2O2 — CID 59804529
N-[4-(trifluoromethoxy)phenyl]-3-[2-(trifluoromethyl)phenyl]indole-1-carboxamide (PubChem CID 59804529) has the molecular formula C23H14F6N2O2 and a molecular weight of 464.37 g/mol. Its IUPAC name is N-[4-(trifluoromethoxy)phenyl]-3-[2-(trifluoromethyl)phenyl]indole-1-carboxamide.
| Compound Name | N-[4-(trifluoromethoxy)phenyl]-3-[2-(trifluoromethyl)phenyl]indole-1-carboxamide |
|---|---|
| PubChem CID | 59804529 |
| Molecular Formula | C23H14F6N2O2 |
| Molecular Weight | 464.37 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | N-[4-(trifluoromethoxy)phenyl]-3-[2-(trifluoromethyl)phenyl]indole-1-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)n1cc(-c2ccccc2C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C23H14F6N2O2/c24-22(25,26)19-7-3-1-5-16(19)18-13-31(20-8-4-2-6-17(18)20)21(32)30-14-9-11-15(12-10-14)33-23(27,28)29/h1-13H,(H,30,32) |
| InChIKey | WOZVGJMFFOHQSM-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.37 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |