C12H13NY-2 — CID 59807163
3-ethenyl-1,2,4,5,6,9-hexahydro-2-benzazepin-4-ide;yttrium (PubChem CID 59807163) has the molecular formula C12H13NY-2 and a molecular weight of 260.15 g/mol. Its IUPAC name is 3-ethenyl-1,2,4,5,6,9-hexahydro-2-benzazepin-4-ide;yttrium.
| Compound Name | 3-ethenyl-1,2,4,5,6,9-hexahydro-2-benzazepin-4-ide;yttrium |
|---|---|
| PubChem CID | 59807163 |
| Molecular Formula | C12H13NY-2 |
| Molecular Weight | 260.15 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | 3-ethenyl-1,2,4,5,6,9-hexahydro-2-benzazepin-4-ide;yttrium |
| SMILES | [H]/[C-]=C/C1=[C-]CC2=C(CC=CC2)CN1.[Y] |
| InChI | InChI=1S/C12H13N.Y/c1-2-12-8-7-10-5-3-4-6-11(10)9-13-12;/h1-4,13H,5-7,9H2;/q-2; |
| InChIKey | JCLCKINDWTUBSL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.15 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|