C28H53N5O5 — CID 59809074
prop-2-enyl N-[6-[[2-(ethylamino)-2-oxoethyl]-[2-[11-(methylamino)undecanoylamino]ethyl]amino]-6-oxohexyl]carbamate (PubChem CID 59809074) has the molecular formula C28H53N5O5 and a molecular weight of 539.76 g/mol. Its IUPAC name is prop-2-enyl N-[6-[[2-(ethylamino)-2-oxoethyl]-[2-[11-(methylamino)undecanoylamino]ethyl]amino]-6-oxohexyl]carbamate.
| Compound Name | prop-2-enyl N-[6-[[2-(ethylamino)-2-oxoethyl]-[2-[11-(methylamino)undecanoylamino]ethyl]amino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 59809074 |
| Molecular Formula | C28H53N5O5 |
| Molecular Weight | 539.76 g/mol |
| Exact Mass | 539.40 |
| IUPAC Name | prop-2-enyl N-[6-[[2-(ethylamino)-2-oxoethyl]-[2-[11-(methylamino)undecanoylamino]ethyl]amino]-6-oxohexyl]carbamate |
| SMILES | C=CCOC(=O)NCCCCCC(=O)N(CCNC(=O)CCCCCCCCCCNC)CC(=O)NCC |
| InChI | InChI=1S/C28H53N5O5/c1-4-23-38-28(37)32-20-16-12-14-18-27(36)33(24-26(35)30-5-2)22-21-31-25(34)17-13-10-8-6-7-9-11-15-19-29-3/h4,29H,1,5-24H2,2-3H3,(H,30,35)(H,31,34)(H,32,37) |
| InChIKey | FTEKYLVYRFUQIX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.76 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|