C31H60N8O6 — CID 59809147
methyl 6-[6-[[2-[6-[2-[(3S)-6-(diaminomethylideneamino)-2-oxohexan-3-yl]hydrazinyl]hexanoyl-propylamino]acetyl]amino]hexanoylamino]hexanoate (PubChem CID 59809147) has the molecular formula C31H60N8O6 and a molecular weight of 640.87 g/mol. Its IUPAC name is methyl 6-[6-[[2-[6-[2-[(3S)-6-(diaminomethylideneamino)-2-oxohexan-3-yl]hydrazinyl]hexanoyl-propylamino]acetyl]amino]hexanoylamino]hexanoate.
| Compound Name | methyl 6-[6-[[2-[6-[2-[(3S)-6-(diaminomethylideneamino)-2-oxohexan-3-yl]hydrazinyl]hexanoyl-propylamino]acetyl]amino]hexanoylamino]hexanoate |
|---|---|
| PubChem CID | 59809147 |
| Molecular Formula | C31H60N8O6 |
| Molecular Weight | 640.87 g/mol |
| Exact Mass | 640.46 |
| IUPAC Name | methyl 6-[6-[[2-[6-[2-[(3S)-6-(diaminomethylideneamino)-2-oxohexan-3-yl]hydrazinyl]hexanoyl-propylamino]acetyl]amino]hexanoylamino]hexanoate |
| SMILES | CCCN(CC(=O)NCCCCCC(=O)NCCCCCC(=O)OC)C(=O)CCCCCNN[C@@H](CCCN=C(N)N)C(C)=O |
| InChI | InChI=1S/C31H60N8O6/c1-4-23-39(29(43)17-9-6-13-22-37-38-26(25(2)40)15-14-21-36-31(32)33)24-28(42)35-20-11-5-8-16-27(41)34-19-12-7-10-18-30(44)45-3/h26,37-38H,4-24H2,1-3H3,(H,34,41)(H,35,42)(H4,32,33,36)/t26-/m0/s1 |
| InChIKey | JCTUYIIMOUFIRS-SANMLTNESA-N |
| XLogP | 1.42 |
| TPSA | 210.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.87 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|