C33H30N2O4S2 — CID 59809427
3-[2-[5-(3-ethylbenzo[g][1,3]benzoxazol-2-ylidene)-3-methylpenta-1,3-dienyl]benzo[e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate (PubChem CID 59809427) has the molecular formula C33H30N2O4S2 and a molecular weight of 582.75 g/mol. Its IUPAC name is 3-[2-[5-(3-ethylbenzo[g][1,3]benzoxazol-2-ylidene)-3-methylpenta-1,3-dienyl]benzo[e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate.
| Compound Name | 3-[2-[5-(3-ethylbenzo[g][1,3]benzoxazol-2-ylidene)-3-methylpenta-1,3-dienyl]benzo[e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 59809427 |
| Molecular Formula | C33H30N2O4S2 |
| Molecular Weight | 582.75 g/mol |
| Exact Mass | 582.16 |
| IUPAC Name | 3-[2-[5-(3-ethylbenzo[g][1,3]benzoxazol-2-ylidene)-3-methylpenta-1,3-dienyl]benzo[e][1,3]benzothiazol-1-ium-1-yl]propane-1-sulfonate |
| SMILES | CCN1C(=CC=C(C)C=Cc2sc3ccc4ccccc4c3[n+]2CCCS(=O)(=O)[O-])Oc2c1ccc1ccccc21 |
| InChI | InChI=1S/C33H30N2O4S2/c1-3-34-28-17-15-25-10-5-7-12-27(25)33(28)39-30(34)19-13-23(2)14-20-31-35(21-8-22-41(36,37)38)32-26-11-6-4-9-24(26)16-18-29(32)40-31/h4-7,9-20H,3,8,21-22H2,1-2H3 |
| InChIKey | KWQNBDMDHWWOLU-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 73.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.75 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|