C25H40N2O — CID 59809896
(6S,8R,9S,10R,13S,14S,17R)-17-[N-(dimethylamino)-C-methylcarbonimidoyl]-6,10,13-trimethyl-3-methylidene-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ol (PubChem CID 59809896) has the molecular formula C25H40N2O and a molecular weight of 384.61 g/mol. Its IUPAC name is (6S,8R,9S,10R,13S,14S,17R)-17-[N-(dimethylamino)-C-methylcarbonimidoyl]-6,10,13-trimethyl-3-methylidene-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (6S,8R,9S,10R,13S,14S,17R)-17-[N-(dimethylamino)-C-methylcarbonimidoyl]-6,10,13-trimethyl-3-methylidene-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 59809896 |
| Molecular Formula | C25H40N2O |
| Molecular Weight | 384.61 g/mol |
| Exact Mass | 384.31 |
| IUPAC Name | (6S,8R,9S,10R,13S,14S,17R)-17-[N-(dimethylamino)-C-methylcarbonimidoyl]-6,10,13-trimethyl-3-methylidene-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ol |
| SMILES | C=C1C=C2[C@@H](C)C[C@@H]3[C@H](CC[C@@]4(C)[C@H]3CC[C@]4(O)C(C)=NN(C)C)[C@@]2(C)CC1 |
| InChI | InChI=1S/C25H40N2O/c1-16-8-11-23(4)20-9-12-24(5)21(19(20)15-17(2)22(23)14-16)10-13-25(24,28)18(3)26-27(6)7/h14,17,19-21,28H,1,8-13,15H2,2-7H3/t17-,19+,20-,21-,23+,24-,25-/m0/s1 |
| InChIKey | YHFWNMZLKAZPKP-WHHPTTACSA-N |
| XLogP | 5.42 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.61 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|