C36H33N2O6P — CID 59810192
5-[4-[4-[bis(phenylmethoxy)phosphorylmethyl]anilino]benzoyl]-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid (PubChem CID 59810192) has the molecular formula C36H33N2O6P and a molecular weight of 620.64 g/mol. Its IUPAC name is 5-[4-[4-[bis(phenylmethoxy)phosphorylmethyl]anilino]benzoyl]-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid.
| Compound Name | 5-[4-[4-[bis(phenylmethoxy)phosphorylmethyl]anilino]benzoyl]-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid |
|---|---|
| PubChem CID | 59810192 |
| Molecular Formula | C36H33N2O6P |
| Molecular Weight | 620.64 g/mol |
| Exact Mass | 620.21 |
| IUPAC Name | 5-[4-[4-[bis(phenylmethoxy)phosphorylmethyl]anilino]benzoyl]-2,3-dihydro-1H-pyrrolizine-1-carboxylic acid |
| SMILES | O=C(c1ccc(Nc2ccc(CP(=O)(OCc3ccccc3)OCc3ccccc3)cc2)cc1)c1ccc2n1CCC2C(=O)O |
| InChI | InChI=1S/C36H33N2O6P/c39-35(34-20-19-33-32(36(40)41)21-22-38(33)34)29-13-17-31(18-14-29)37-30-15-11-28(12-16-30)25-45(42,43-23-26-7-3-1-4-8-26)44-24-27-9-5-2-6-10-27/h1-20,32,37H,21-25H2,(H,40,41) |
| InChIKey | VGXBBNSWLOYQCG-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.64 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|