C24H23N3O2 — CID 59812101
N-cyclohexyl-2-[3-(furan-3-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]benzamide (PubChem CID 59812101) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is N-cyclohexyl-2-[3-(furan-3-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]benzamide.
| Compound Name | N-cyclohexyl-2-[3-(furan-3-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]benzamide |
|---|---|
| PubChem CID | 59812101 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | N-cyclohexyl-2-[3-(furan-3-yl)-1H-pyrrolo[2,3-b]pyridin-5-yl]benzamide |
| SMILES | O=C(NC1CCCCC1)c1ccccc1-c1cnc2[nH]cc(-c3ccoc3)c2c1 |
| InChI | InChI=1S/C24H23N3O2/c28-24(27-18-6-2-1-3-7-18)20-9-5-4-8-19(20)17-12-21-22(16-10-11-29-15-16)14-26-23(21)25-13-17/h4-5,8-15,18H,1-3,6-7H2,(H,25,26)(H,27,28) |
| InChIKey | YVYGIKDVINZQGC-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |