C18H18FN5O — CID 156501633
5-(2-fluoro-3-pyridinyl)-N-piperidin-4-yl-1H-pyrrolo[2,3-b]pyridine-3-carboxamide (PubChem CID 156501633) has the molecular formula C18H18FN5O and a molecular weight of 339.37 g/mol. Its IUPAC name is 5-(2-fluoro-3-pyridinyl)-N-piperidin-4-yl-1H-pyrrolo[2,3-b]pyridine-3-carboxamide.
| Compound Name | 5-(2-fluoro-3-pyridinyl)-N-piperidin-4-yl-1H-pyrrolo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 156501633 |
| Molecular Formula | C18H18FN5O |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 5-(2-fluoro-3-pyridinyl)-N-piperidin-4-yl-1H-pyrrolo[2,3-b]pyridine-3-carboxamide |
| SMILES | O=C(NC1CCNCC1)c1c[nH]c2ncc(-c3cccnc3F)cc12 |
| InChI | InChI=1S/C18H18FN5O/c19-16-13(2-1-5-21-16)11-8-14-15(10-23-17(14)22-9-11)18(25)24-12-3-6-20-7-4-12/h1-2,5,8-10,12,20H,3-4,6-7H2,(H,22,23)(H,24,25) |
| InChIKey | ZQTKPPMAYIXKBH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|