C20H20FN3O — CID 175283062
5-(2-fluorophenyl)-N-piperidin-4-yl-1H-indole-3-carboxamide (PubChem CID 175283062) has the molecular formula C20H20FN3O and a molecular weight of 337.40 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-N-piperidin-4-yl-1H-indole-3-carboxamide.
| Compound Name | 5-(2-fluorophenyl)-N-piperidin-4-yl-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 175283062 |
| Molecular Formula | C20H20FN3O |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 5-(2-fluorophenyl)-N-piperidin-4-yl-1H-indole-3-carboxamide |
| SMILES | O=C(NC1CCNCC1)c1c[nH]c2ccc(-c3ccccc3F)cc12 |
| InChI | InChI=1S/C20H20FN3O/c21-18-4-2-1-3-15(18)13-5-6-19-16(11-13)17(12-23-19)20(25)24-14-7-9-22-10-8-14/h1-6,11-12,14,22-23H,7-10H2,(H,24,25) |
| InChIKey | BILOEBCJBGYJEE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |