C15H17N3O4 — CID 59815231
ethyl (2E,5E)-2-cyano-6-[cyano(2-prop-2-enoyloxyethyl)amino]hexa-2,5-dienoate (PubChem CID 59815231) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is ethyl (2E,5E)-2-cyano-6-[cyano(2-prop-2-enoyloxyethyl)amino]hexa-2,5-dienoate.
| Compound Name | ethyl (2E,5E)-2-cyano-6-[cyano(2-prop-2-enoyloxyethyl)amino]hexa-2,5-dienoate |
|---|---|
| PubChem CID | 59815231 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | ethyl (2E,5E)-2-cyano-6-[cyano(2-prop-2-enoyloxyethyl)amino]hexa-2,5-dienoate |
| SMILES | C=CC(=O)OCCN(C#N)/C=C/C/C=C(\C#N)C(=O)OCC |
| InChI | InChI=1S/C15H17N3O4/c1-3-14(19)22-10-9-18(12-17)8-6-5-7-13(11-16)15(20)21-4-2/h3,6-8H,1,4-5,9-10H2,2H3/b8-6+,13-7+ |
| InChIKey | SRLOQRLPYCRCIT-NQSFVOBFSA-N |
| XLogP | 1.42 |
| TPSA | 103.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|