C23H23N5O2 — CID 59824141
N-[(2,6-dimethylphenyl)methyl]-2,3-dimethyl-6-(5-nitro-2-pyridinyl)imidazo[1,2-a]pyridin-8-amine (PubChem CID 59824141) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is N-[(2,6-dimethylphenyl)methyl]-2,3-dimethyl-6-(5-nitro-2-pyridinyl)imidazo[1,2-a]pyridin-8-amine.
| Compound Name | N-[(2,6-dimethylphenyl)methyl]-2,3-dimethyl-6-(5-nitro-2-pyridinyl)imidazo[1,2-a]pyridin-8-amine |
|---|---|
| PubChem CID | 59824141 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | N-[(2,6-dimethylphenyl)methyl]-2,3-dimethyl-6-(5-nitro-2-pyridinyl)imidazo[1,2-a]pyridin-8-amine |
| SMILES | Cc1cccc(C)c1CNc1cc(-c2ccc([N+](=O)[O-])cn2)cn2c(C)c(C)nc12 |
| InChI | InChI=1S/C23H23N5O2/c1-14-6-5-7-15(2)20(14)12-25-22-10-18(13-27-17(4)16(3)26-23(22)27)21-9-8-19(11-24-21)28(29)30/h5-11,13,25H,12H2,1-4H3 |
| InChIKey | ZHKZHIOHONJYHA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|