C15H19BCl2NO3 — CID 59825938
CID 59825938 (PubChem CID 59825938) has the molecular formula C15H19BCl2NO3 and a molecular weight of 343.04 g/mol.
| Compound Name | CID 59825938 |
|---|---|
| PubChem CID | 59825938 |
| Molecular Formula | C15H19BCl2NO3 |
| Molecular Weight | 343.04 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | — |
| SMILES | C[B]C(=O)N1CCOC(CCOC)(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C15H19BCl2NO3/c1-16-14(20)19-6-8-22-15(10-19,5-7-21-2)11-3-4-12(17)13(18)9-11/h3-4,9H,5-8,10H2,1-2H3 |
| InChIKey | QUPXKQXHDKMOCE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.04 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|