C27H20Cl2F6N2O7S — CID 11422624
2-[4-[3,5-bis(trifluoromethyl)benzoyl]-2-(3,4-dichlorophenyl)morpholin-2-yl]ethyl 4-nitrobenzenesulfonate (PubChem CID 11422624) has the molecular formula C27H20Cl2F6N2O7S and a molecular weight of 701.43 g/mol. Its IUPAC name is 2-[4-[3,5-bis(trifluoromethyl)benzoyl]-2-(3,4-dichlorophenyl)morpholin-2-yl]ethyl 4-nitrobenzenesulfonate.
| Compound Name | 2-[4-[3,5-bis(trifluoromethyl)benzoyl]-2-(3,4-dichlorophenyl)morpholin-2-yl]ethyl 4-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 11422624 |
| Molecular Formula | C27H20Cl2F6N2O7S |
| Molecular Weight | 701.43 g/mol |
| Exact Mass | 700.03 |
| IUPAC Name | 2-[4-[3,5-bis(trifluoromethyl)benzoyl]-2-(3,4-dichlorophenyl)morpholin-2-yl]ethyl 4-nitrobenzenesulfonate |
| SMILES | O=C(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N1CCOC(CCOS(=O)(=O)c2ccc([N+](=O)[O-])cc2)(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C27H20Cl2F6N2O7S/c28-22-6-1-17(14-23(22)29)25(7-9-44-45(41,42)21-4-2-20(3-5-21)37(39)40)15-36(8-10-43-25)24(38)16-11-18(26(30,31)32)13-19(12-16)27(33,34)35/h1-6,11-14H,7-10,15H2 |
| InChIKey | QWNCPFNPEHVJBR-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.43 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|