C28H28Cl2N2O10S — CID 87798672
2-[1-[2-(3,4-dichlorophenyl)-4-(3,4,5-trimethoxybenzoyl)morpholin-2-yl]ethyl]-4-nitrobenzenesulfonic acid (PubChem CID 87798672) has the molecular formula C28H28Cl2N2O10S and a molecular weight of 655.51 g/mol. Its IUPAC name is 2-[1-[2-(3,4-dichlorophenyl)-4-(3,4,5-trimethoxybenzoyl)morpholin-2-yl]ethyl]-4-nitrobenzenesulfonic acid.
| Compound Name | 2-[1-[2-(3,4-dichlorophenyl)-4-(3,4,5-trimethoxybenzoyl)morpholin-2-yl]ethyl]-4-nitrobenzenesulfonic acid |
|---|---|
| PubChem CID | 87798672 |
| Molecular Formula | C28H28Cl2N2O10S |
| Molecular Weight | 655.51 g/mol |
| Exact Mass | 654.08 |
| IUPAC Name | 2-[1-[2-(3,4-dichlorophenyl)-4-(3,4,5-trimethoxybenzoyl)morpholin-2-yl]ethyl]-4-nitrobenzenesulfonic acid |
| SMILES | COc1cc(C(=O)N2CCOC(c3ccc(Cl)c(Cl)c3)(C(C)c3cc([N+](=O)[O-])ccc3S(=O)(=O)O)C2)cc(OC)c1OC |
| InChI | InChI=1S/C28H28Cl2N2O10S/c1-16(20-14-19(32(34)35)6-8-25(20)43(36,37)38)28(18-5-7-21(29)22(30)13-18)15-31(9-10-42-28)27(33)17-11-23(39-2)26(41-4)24(12-17)40-3/h5-8,11-14,16H,9-10,15H2,1-4H3,(H,36,37,38) |
| InChIKey | FDJHHNBWTJJPFE-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 154.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.51 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|