C28H30Cl2N2O10S — CID 87799395
(6R)-6-[1-[2-(3,4-dichlorophenyl)-4-(3,4,5-trimethoxybenzoyl)morpholin-2-yl]ethyl]-6-nitrocyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 87799395) has the molecular formula C28H30Cl2N2O10S and a molecular weight of 657.53 g/mol. Its IUPAC name is (6R)-6-[1-[2-(3,4-dichlorophenyl)-4-(3,4,5-trimethoxybenzoyl)morpholin-2-yl]ethyl]-6-nitrocyclohexa-2,4-diene-1-sulfonic acid.
| Compound Name | (6R)-6-[1-[2-(3,4-dichlorophenyl)-4-(3,4,5-trimethoxybenzoyl)morpholin-2-yl]ethyl]-6-nitrocyclohexa-2,4-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 87799395 |
| Molecular Formula | C28H30Cl2N2O10S |
| Molecular Weight | 657.53 g/mol |
| Exact Mass | 656.10 |
| IUPAC Name | (6R)-6-[1-[2-(3,4-dichlorophenyl)-4-(3,4,5-trimethoxybenzoyl)morpholin-2-yl]ethyl]-6-nitrocyclohexa-2,4-diene-1-sulfonic acid |
| SMILES | COc1cc(C(=O)N2CCOC(c3ccc(Cl)c(Cl)c3)(C(C)[C@]3([N+](=O)[O-])C=CC=CC3S(=O)(=O)O)C2)cc(OC)c1OC |
| InChI | InChI=1S/C28H30Cl2N2O10S/c1-17(27(32(34)35)10-6-5-7-24(27)43(36,37)38)28(19-8-9-20(29)21(30)15-19)16-31(11-12-42-28)26(33)18-13-22(39-2)25(41-4)23(14-18)40-3/h5-10,13-15,17,24H,11-12,16H2,1-4H3,(H,36,37,38)/t17?,24?,27-,28?/m1/s1 |
| InChIKey | IUPFSFAXMPUIQC-UVDDEKAUSA-N |
| XLogP | 4.42 |
| TPSA | 154.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|