C29H30Cl2N2O9S — CID 87799117
2-[2-[3-(3,4-dichlorophenyl)-1-(3,4,5-trimethoxybenzoyl)piperidin-3-yl]ethyl]-4-nitrobenzenesulfonic acid (PubChem CID 87799117) has the molecular formula C29H30Cl2N2O9S and a molecular weight of 653.54 g/mol. Its IUPAC name is 2-[2-[3-(3,4-dichlorophenyl)-1-(3,4,5-trimethoxybenzoyl)piperidin-3-yl]ethyl]-4-nitrobenzenesulfonic acid.
| Compound Name | 2-[2-[3-(3,4-dichlorophenyl)-1-(3,4,5-trimethoxybenzoyl)piperidin-3-yl]ethyl]-4-nitrobenzenesulfonic acid |
|---|---|
| PubChem CID | 87799117 |
| Molecular Formula | C29H30Cl2N2O9S |
| Molecular Weight | 653.54 g/mol |
| Exact Mass | 652.10 |
| IUPAC Name | 2-[2-[3-(3,4-dichlorophenyl)-1-(3,4,5-trimethoxybenzoyl)piperidin-3-yl]ethyl]-4-nitrobenzenesulfonic acid |
| SMILES | COc1cc(C(=O)N2CCCC(CCc3cc([N+](=O)[O-])ccc3S(=O)(=O)O)(c3ccc(Cl)c(Cl)c3)C2)cc(OC)c1OC |
| InChI | InChI=1S/C29H30Cl2N2O9S/c1-40-24-14-19(15-25(41-2)27(24)42-3)28(34)32-12-4-10-29(17-32,20-5-7-22(30)23(31)16-20)11-9-18-13-21(33(35)36)6-8-26(18)43(37,38)39/h5-8,13-16H,4,9-12,17H2,1-3H3,(H,37,38,39) |
| InChIKey | BEQVGYWWKQWICF-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 145.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.54 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|