C20H35N3O5S — CID 59826455
N,N-bis(2-methoxyethyl)-3-[(3-morpholin-4-ylpropylamino)methyl]benzenesulfonamide (PubChem CID 59826455) has the molecular formula C20H35N3O5S and a molecular weight of 429.58 g/mol. Its IUPAC name is N,N-bis(2-methoxyethyl)-3-[(3-morpholin-4-ylpropylamino)methyl]benzenesulfonamide.
| Compound Name | N,N-bis(2-methoxyethyl)-3-[(3-morpholin-4-ylpropylamino)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 59826455 |
| Molecular Formula | C20H35N3O5S |
| Molecular Weight | 429.58 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | N,N-bis(2-methoxyethyl)-3-[(3-morpholin-4-ylpropylamino)methyl]benzenesulfonamide |
| SMILES | COCCN(CCOC)S(=O)(=O)c1cccc(CNCCCN2CCOCC2)c1 |
| InChI | InChI=1S/C20H35N3O5S/c1-26-13-11-23(12-14-27-2)29(24,25)20-6-3-5-19(17-20)18-21-7-4-8-22-9-15-28-16-10-22/h3,5-6,17,21H,4,7-16,18H2,1-2H3 |
| InChIKey | QHSPYROBRYRPIB-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.58 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|