C23H29N3O7S — CID 59829843
3-[2,4-bis(methoxymethoxy)-5-propan-2-ylphenyl]-4-(4-methoxyphenyl)-5-methylsulfonyl-1,2,4-triazole (PubChem CID 59829843) has the molecular formula C23H29N3O7S and a molecular weight of 491.57 g/mol. Its IUPAC name is 3-[2,4-bis(methoxymethoxy)-5-propan-2-ylphenyl]-4-(4-methoxyphenyl)-5-methylsulfonyl-1,2,4-triazole.
| Compound Name | 3-[2,4-bis(methoxymethoxy)-5-propan-2-ylphenyl]-4-(4-methoxyphenyl)-5-methylsulfonyl-1,2,4-triazole |
|---|---|
| PubChem CID | 59829843 |
| Molecular Formula | C23H29N3O7S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | 3-[2,4-bis(methoxymethoxy)-5-propan-2-ylphenyl]-4-(4-methoxyphenyl)-5-methylsulfonyl-1,2,4-triazole |
| SMILES | COCOc1cc(OCOC)c(C(C)C)cc1-c1nnc(S(C)(=O)=O)n1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H29N3O7S/c1-15(2)18-11-19(21(33-14-30-4)12-20(18)32-13-29-3)22-24-25-23(34(6,27)28)26(22)16-7-9-17(31-5)10-8-16/h7-12,15H,13-14H2,1-6H3 |
| InChIKey | PZIMGEGDMUWPJY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 111.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|