About 2,6-dimethyl-3H-pyridin-3-ide;tungsten
2,6-dimethyl-3H-pyridin-3-ide;tungsten (PubChem CID 59830635) has the molecular formula C7H8NW-
and a molecular weight of 289.99 g/mol. Its IUPAC name is 2,6-dimethyl-3H-pyridin-3-ide;tungsten.
Molecular Properties
| Compound Name | 2,6-dimethyl-3H-pyridin-3-ide;tungsten |
| PubChem CID | 59830635 |
| Molecular Formula | C7H8NW- |
| Molecular Weight | 289.99 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 2,6-dimethyl-3H-pyridin-3-ide;tungsten |
| SMILES | Cc1[c-]ccc(C)n1.[W] |
| InChI | InChI=1S/C7H8N.W/c1-6-4-3-5-7(2)8-6;/h3-4H,1-2H3;/q-1; |
| InChIKey | ILUYAXVDAMZZCY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.99 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethyl-3H-pyridin-3-ide;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-3H-pyridin-3-ide;tungsten?
The IUPAC name of 2,6-dimethyl-3H-pyridin-3-ide;tungsten (CID 59830635) is 2,6-dimethyl-3H-pyridin-3-ide;tungsten.
What is the SMILES notation for 2,6-dimethyl-3H-pyridin-3-ide;tungsten?
The canonical SMILES for 2,6-dimethyl-3H-pyridin-3-ide;tungsten is Cc1[c-]ccc(C)n1.[W].
What is the InChIKey of 2,6-dimethyl-3H-pyridin-3-ide;tungsten?
The InChIKey is ILUYAXVDAMZZCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N.W/c1-6-4-3-5-7(2)8-6;/h3-4H,1-2H3;/q-1;.
What are the key properties of 2,6-dimethyl-3H-pyridin-3-ide;tungsten?
2,6-dimethyl-3H-pyridin-3-ide;tungsten has a molecular weight of 289.99 g/mol, XLogP of 1.50, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-3H-pyridin-3-ide;tungsten is sourced from PubChem (CID 59830635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).