About bromozinc(1+);2,6-dimethyl-3H-pyridin-3-ide
bromozinc(1+);2,6-dimethyl-3H-pyridin-3-ide (PubChem CID 59470147) has the molecular formula C7H8BrNZn
and a molecular weight of 251.44 g/mol. Its IUPAC name is bromozinc(1+);2,6-dimethyl-3H-pyridin-3-ide.
Molecular Properties
| Compound Name | bromozinc(1+);2,6-dimethyl-3H-pyridin-3-ide |
| PubChem CID | 59470147 |
| Molecular Formula | C7H8BrNZn |
| Molecular Weight | 251.44 g/mol |
| Exact Mass | 248.91 |
| IUPAC Name | bromozinc(1+);2,6-dimethyl-3H-pyridin-3-ide |
| SMILES | Cc1[c-]ccc(C)n1.[Zn+]Br |
| InChI | InChI=1S/C7H8N.BrH.Zn/c1-6-4-3-5-7(2)8-6;;/h3-4H,1-2H3;1H;/q-1;;+2/p-1 |
| InChIKey | BXKURFFEASNVBH-UHFFFAOYSA-M |
| XLogP | 2.34 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bromozinc(1+);2,6-dimethyl-3H-pyridin-3-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromozinc(1+);2,6-dimethyl-3H-pyridin-3-ide?
The IUPAC name of bromozinc(1+);2,6-dimethyl-3H-pyridin-3-ide (CID 59470147) is bromozinc(1+);2,6-dimethyl-3H-pyridin-3-ide.
What is the SMILES notation for bromozinc(1+);2,6-dimethyl-3H-pyridin-3-ide?
The canonical SMILES for bromozinc(1+);2,6-dimethyl-3H-pyridin-3-ide is Cc1[c-]ccc(C)n1.[Zn+]Br.
What is the InChIKey of bromozinc(1+);2,6-dimethyl-3H-pyridin-3-ide?
The InChIKey is BXKURFFEASNVBH-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8N.BrH.Zn/c1-6-4-3-5-7(2)8-6;;/h3-4H,1-2H3;1H;/q-1;;+2/p-1.
What are the key properties of bromozinc(1+);2,6-dimethyl-3H-pyridin-3-ide?
bromozinc(1+);2,6-dimethyl-3H-pyridin-3-ide has a molecular weight of 251.44 g/mol, XLogP of 2.34, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bromozinc(1+);2,6-dimethyl-3H-pyridin-3-ide is sourced from PubChem (CID 59470147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).