C16H27NO — CID 59833437
4-[2-(2,2-dimethylpropylamino)-4-methylphenyl]butan-1-ol (PubChem CID 59833437) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is 4-[2-(2,2-dimethylpropylamino)-4-methylphenyl]butan-1-ol.
| Compound Name | 4-[2-(2,2-dimethylpropylamino)-4-methylphenyl]butan-1-ol |
|---|---|
| PubChem CID | 59833437 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 4-[2-(2,2-dimethylpropylamino)-4-methylphenyl]butan-1-ol |
| SMILES | Cc1ccc(CCCCO)c(NCC(C)(C)C)c1 |
| InChI | InChI=1S/C16H27NO/c1-13-8-9-14(7-5-6-10-18)15(11-13)17-12-16(2,3)4/h8-9,11,17-18H,5-7,10,12H2,1-4H3 |
| InChIKey | PKYRCXZZPBNNJQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|