C14H23NO — CID 71051945
4-[4-methyl-2-(propylamino)phenyl]butan-2-ol (PubChem CID 71051945) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 4-[4-methyl-2-(propylamino)phenyl]butan-2-ol.
| Compound Name | 4-[4-methyl-2-(propylamino)phenyl]butan-2-ol |
|---|---|
| PubChem CID | 71051945 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 4-[4-methyl-2-(propylamino)phenyl]butan-2-ol |
| SMILES | CCCNc1cc(C)ccc1CCC(C)O |
| InChI | InChI=1S/C14H23NO/c1-4-9-15-14-10-11(2)5-7-13(14)8-6-12(3)16/h5,7,10,12,15-16H,4,6,8-9H2,1-3H3 |
| InChIKey | DBXROAKWLVWGII-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |