C12H21ClN2O3 — CID 59838984
tert-butyl N-[carbonochloridoyl(hex-5-enyl)amino]carbamate (PubChem CID 59838984) has the molecular formula C12H21ClN2O3 and a molecular weight of 276.76 g/mol. Its IUPAC name is tert-butyl N-[carbonochloridoyl(hex-5-enyl)amino]carbamate.
| Compound Name | tert-butyl N-[carbonochloridoyl(hex-5-enyl)amino]carbamate |
|---|---|
| PubChem CID | 59838984 |
| Molecular Formula | C12H21ClN2O3 |
| Molecular Weight | 276.76 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | tert-butyl N-[carbonochloridoyl(hex-5-enyl)amino]carbamate |
| SMILES | C=CCCCCN(NC(=O)OC(C)(C)C)C(=O)Cl |
| InChI | InChI=1S/C12H21ClN2O3/c1-5-6-7-8-9-15(10(13)16)14-11(17)18-12(2,3)4/h5H,1,6-9H2,2-4H3,(H,14,17) |
| InChIKey | CGIKIXCFQLPHTD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.76 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|