C16H29NO4S — CID 59084503
(3R)-4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-pent-4-enylsulfanylpentanoic acid (PubChem CID 59084503) has the molecular formula C16H29NO4S and a molecular weight of 331.48 g/mol. Its IUPAC name is (3R)-4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-pent-4-enylsulfanylpentanoic acid.
| Compound Name | (3R)-4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-pent-4-enylsulfanylpentanoic acid |
|---|---|
| PubChem CID | 59084503 |
| Molecular Formula | C16H29NO4S |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | (3R)-4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-pent-4-enylsulfanylpentanoic acid |
| SMILES | C=CCCCSC(C)(C)[C@@H](CC(=O)O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H29NO4S/c1-7-8-9-10-22-16(5,6)12(11-13(18)19)17-14(20)21-15(2,3)4/h7,12H,1,8-11H2,2-6H3,(H,17,20)(H,18,19)/t12-/m1/s1 |
| InChIKey | ULPIGXVETPQYFS-GFCCVEGCSA-N |
| XLogP | 3.83 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|