C17H29NO6S — CID 57108990
prop-2-enyl (2S)-3-(3-methoxy-3-oxopropyl)sulfanyl-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 57108990) has the molecular formula C17H29NO6S and a molecular weight of 375.49 g/mol. Its IUPAC name is prop-2-enyl (2S)-3-(3-methoxy-3-oxopropyl)sulfanyl-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | prop-2-enyl (2S)-3-(3-methoxy-3-oxopropyl)sulfanyl-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 57108990 |
| Molecular Formula | C17H29NO6S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | prop-2-enyl (2S)-3-(3-methoxy-3-oxopropyl)sulfanyl-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | C=CCOC(=O)[C@H](NC(=O)OC(C)(C)C)C(C)(C)SCCC(=O)OC |
| InChI | InChI=1S/C17H29NO6S/c1-8-10-23-14(20)13(18-15(21)24-16(2,3)4)17(5,6)25-11-9-12(19)22-7/h8,13H,1,9-11H2,2-7H3,(H,18,21)/t13-/m0/s1 |
| InChIKey | QKIYFDFXDPUHEF-ZDUSSCGKSA-N |
| XLogP | 2.68 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|