C25H31ClFO5 — CID 59839726
CID 59839726 (PubChem CID 59839726) has the molecular formula C25H31ClFO5 and a molecular weight of 465.97 g/mol.
| Compound Name | CID 59839726 |
|---|---|
| PubChem CID | 59839726 |
| Molecular Formula | C25H31ClFO5 |
| Molecular Weight | 465.97 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | — |
| SMILES | CCC(=O)OC1(C(=O)CCl)C(C)CC2C3CCC4=CC(=O)C=CC4(C)C3(F)C(O)[CH]C21C |
| InChI | InChI=1S/C25H31ClFO5/c1-5-21(31)32-25(20(30)13-26)14(2)10-18-17-7-6-15-11-16(28)8-9-22(15,3)24(17,27)19(29)12-23(18,25)4/h8-9,11-12,14,17-19,29H,5-7,10,13H2,1-4H3 |
| InChIKey | SFRRNHMJPBLZGP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.97 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|