C32H54O9 — CID 59840847
[(4E)-10-hydroxy-7-methoxy-3,7-dimethyl-12-oxo-2-[(2E,4E)-6,8,11-trihydroxy-6,9,10-trimethyltrideca-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] acetate (PubChem CID 59840847) has the molecular formula C32H54O9 and a molecular weight of 582.78 g/mol. Its IUPAC name is [(4E)-10-hydroxy-7-methoxy-3,7-dimethyl-12-oxo-2-[(2E,4E)-6,8,11-trihydroxy-6,9,10-trimethyltrideca-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] acetate.
| Compound Name | [(4E)-10-hydroxy-7-methoxy-3,7-dimethyl-12-oxo-2-[(2E,4E)-6,8,11-trihydroxy-6,9,10-trimethyltrideca-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] acetate |
|---|---|
| PubChem CID | 59840847 |
| Molecular Formula | C32H54O9 |
| Molecular Weight | 582.78 g/mol |
| Exact Mass | 582.38 |
| IUPAC Name | [(4E)-10-hydroxy-7-methoxy-3,7-dimethyl-12-oxo-2-[(2E,4E)-6,8,11-trihydroxy-6,9,10-trimethyltrideca-2,4-dien-2-yl]-1-oxacyclododec-4-en-6-yl] acetate |
| SMILES | CCC(O)C(C)C(C)C(O)CC(C)(O)/C=C/C=C(\C)C1OC(=O)CC(O)CCC(C)(OC)C(OC(C)=O)/C=C/C1C |
| InChI | InChI=1S/C32H54O9/c1-10-26(35)22(4)23(5)27(36)19-31(7,38)16-11-12-20(2)30-21(3)13-14-28(40-24(6)33)32(8,39-9)17-15-25(34)18-29(37)41-30/h11-14,16,21-23,25-28,30,34-36,38H,10,15,17-19H2,1-9H3/b14-13+,16-11+,20-12+ |
| InChIKey | QRGWGRHPRLFQNN-KTINPCEZSA-N |
| XLogP | 4.02 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.78 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|