C29H40O7 — CID 146191415
[(2S,3S,4E,6S,7R,10R)-7,10-dihydroxy-2-[(2E,4E)-6-hydroxy-6-methyl-7-phenylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate (PubChem CID 146191415) has the molecular formula C29H40O7 and a molecular weight of 500.63 g/mol. Its IUPAC name is [(2S,3S,4E,6S,7R,10R)-7,10-dihydroxy-2-[(2E,4E)-6-hydroxy-6-methyl-7-phenylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate.
| Compound Name | [(2S,3S,4E,6S,7R,10R)-7,10-dihydroxy-2-[(2E,4E)-6-hydroxy-6-methyl-7-phenylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate |
|---|---|
| PubChem CID | 146191415 |
| Molecular Formula | C29H40O7 |
| Molecular Weight | 500.63 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | [(2S,3S,4E,6S,7R,10R)-7,10-dihydroxy-2-[(2E,4E)-6-hydroxy-6-methyl-7-phenylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate |
| SMILES | CC(=O)O[C@H]1/C=C/[C@H](C)[C@@H](/C(C)=C/C=C/C(C)(O)Cc2ccccc2)OC(=O)C[C@H](O)CC[C@@]1(C)O |
| InChI | InChI=1S/C29H40O7/c1-20(10-9-16-28(4,33)19-23-11-7-6-8-12-23)27-21(2)13-14-25(35-22(3)30)29(5,34)17-15-24(31)18-26(32)36-27/h6-14,16,21,24-25,27,31,33-34H,15,17-19H2,1-5H3/b14-13+,16-9+,20-10+/t21-,24+,25-,27+,28?,29+/m0/s1 |
| InChIKey | IBWVOWIKMMBTKJ-FHAZBIBVSA-N |
| XLogP | 3.81 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.63 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|