C26H36O7S — CID 146173259
[(2S,3S,4E,6R,7R,10R)-7,10-dihydroxy-2-[(2E,4E)-6-hydroxy-6-thiophen-2-ylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate (PubChem CID 146173259) has the molecular formula C26H36O7S and a molecular weight of 492.63 g/mol. Its IUPAC name is [(2S,3S,4E,6R,7R,10R)-7,10-dihydroxy-2-[(2E,4E)-6-hydroxy-6-thiophen-2-ylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate.
| Compound Name | [(2S,3S,4E,6R,7R,10R)-7,10-dihydroxy-2-[(2E,4E)-6-hydroxy-6-thiophen-2-ylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate |
|---|---|
| PubChem CID | 146173259 |
| Molecular Formula | C26H36O7S |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.22 |
| IUPAC Name | [(2S,3S,4E,6R,7R,10R)-7,10-dihydroxy-2-[(2E,4E)-6-hydroxy-6-thiophen-2-ylhepta-2,4-dien-2-yl]-3,7-dimethyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate |
| SMILES | CC(=O)O[C@@H]1/C=C/[C@H](C)[C@@H](/C(C)=C/C=C/C(C)(O)c2cccs2)OC(=O)C[C@H](O)CC[C@@]1(C)O |
| InChI | InChI=1S/C26H36O7S/c1-17(8-6-13-26(5,31)22-9-7-15-34-22)24-18(2)10-11-21(32-19(3)27)25(4,30)14-12-20(28)16-23(29)33-24/h6-11,13,15,18,20-21,24,28,30-31H,12,14,16H2,1-5H3/b11-10+,13-6+,17-8+/t18-,20+,21+,24+,25+,26?/m0/s1 |
| InChIKey | JZLFAZXAZDLEBA-CCOXIZPNSA-N |
| XLogP | 3.79 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|