C34H33F8IrN2O2- — CID 59844752
5-(3-fluorophenyl)-2-(4-methylbenzene-6-id-1-yl)-3-(4-methylphenyl)pyrazine;6,6,7,7,8,8,8-heptafluoro-2,2-dimethyloctane-3,5-diol;iridium (PubChem CID 59844752) has the molecular formula C34H33F8IrN2O2- and a molecular weight of 845.85 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-2-(4-methylbenzene-6-id-1-yl)-3-(4-methylphenyl)pyrazine;6,6,7,7,8,8,8-heptafluoro-2,2-dimethyloctane-3,5-diol;iridium.
| Compound Name | 5-(3-fluorophenyl)-2-(4-methylbenzene-6-id-1-yl)-3-(4-methylphenyl)pyrazine;6,6,7,7,8,8,8-heptafluoro-2,2-dimethyloctane-3,5-diol;iridium |
|---|---|
| PubChem CID | 59844752 |
| Molecular Formula | C34H33F8IrN2O2- |
| Molecular Weight | 845.85 g/mol |
| Exact Mass | 846.20 |
| IUPAC Name | 5-(3-fluorophenyl)-2-(4-methylbenzene-6-id-1-yl)-3-(4-methylphenyl)pyrazine;6,6,7,7,8,8,8-heptafluoro-2,2-dimethyloctane-3,5-diol;iridium |
| SMILES | CC(C)(C)C(O)CC(O)C(F)(F)C(F)(F)C(F)(F)F.Cc1c[c-]c(-c2ncc(-c3cccc(F)c3)nc2-c2ccc(C)cc2)cc1.[Ir] |
| InChI | InChI=1S/C24H18FN2.C10H15F7O2.Ir/c1-16-6-10-18(11-7-16)23-24(19-12-8-17(2)9-13-19)27-22(15-26-23)20-4-3-5-21(25)14-20;1-7(2,3)5(18)4-6(19)8(11,12)9(13,14)10(15,16)17;/h3-10,12-15H,1-2H3;5-6,18-19H,4H2,1-3H3;/q-1;; |
| InChIKey | SHQCIDVRLGOSMY-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.85 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|