C30H20N2 — CID 59844805
2,3,4,5,6,7-hexadeuterio-9-[3-(2,3,4,5,6,7-hexadeuteriocarbazol-9-yl)phenyl]carbazole (PubChem CID 59844805) has the molecular formula C30H20N2 and a molecular weight of 420.58 g/mol. Its IUPAC name is 2,3,4,5,6,7-hexadeuterio-9-[3-(2,3,4,5,6,7-hexadeuteriocarbazol-9-yl)phenyl]carbazole.
| Compound Name | 2,3,4,5,6,7-hexadeuterio-9-[3-(2,3,4,5,6,7-hexadeuteriocarbazol-9-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 59844805 |
| Molecular Formula | C30H20N2 |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | 2,3,4,5,6,7-hexadeuterio-9-[3-(2,3,4,5,6,7-hexadeuteriocarbazol-9-yl)phenyl]carbazole |
| SMILES | [2H]c1cc2c(c([2H])c1[2H])c1c([2H])c([2H])c([2H])cc1n2-c1cccc(-n2c3cc([2H])c([2H])c([2H])c3c3c([2H])c([2H])c([2H])cc32)c1 |
| InChI | InChI=1S/C30H20N2/c1-5-16-27-23(12-1)24-13-2-6-17-28(24)31(27)21-10-9-11-22(20-21)32-29-18-7-3-14-25(29)26-15-4-8-19-30(26)32/h1-20H/i1D,2D,3D,4D,5D,6D,7D,8D,12D,13D,14D,15D |
| InChIKey | MZYDBGLUVPLRKR-ADTURKIFSA-N |
| XLogP | 7.88 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |