C28H32F3N7O4 — CID 59845656
(2R)-2-[[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]amino]-3-phenylpropanamide (PubChem CID 59845656) has the molecular formula C28H32F3N7O4 and a molecular weight of 587.60 g/mol. Its IUPAC name is (2R)-2-[[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]amino]-3-phenylpropanamide.
| Compound Name | (2R)-2-[[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 59845656 |
| Molecular Formula | C28H32F3N7O4 |
| Molecular Weight | 587.60 g/mol |
| Exact Mass | 587.25 |
| IUPAC Name | (2R)-2-[[4-[[[5-nitro-2-[[2-(trifluoromethoxy)phenyl]methylamino]pyrimidin-4-yl]amino]methyl]cyclohexyl]amino]-3-phenylpropanamide |
| SMILES | NC(=O)[C@@H](Cc1ccccc1)NC1CCC(CNc2nc(NCc3ccccc3OC(F)(F)F)ncc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C28H32F3N7O4/c29-28(30,31)42-24-9-5-4-8-20(24)16-34-27-35-17-23(38(40)41)26(37-27)33-15-19-10-12-21(13-11-19)36-22(25(32)39)14-18-6-2-1-3-7-18/h1-9,17,19,21-22,36H,10-16H2,(H2,32,39)(H2,33,34,35,37)/t19?,21?,22-/m1/s1 |
| InChIKey | UMKQYRSILMAFFC-KITAHSCOSA-N |
| XLogP | 4.55 |
| TPSA | 157.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.60 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|