C20H14N8O — CID 59846493
2-(5-isocyanobenzimidazol-1-yl)-9-(1-pyridin-3-ylethyl)-7H-purin-8-one (PubChem CID 59846493) has the molecular formula C20H14N8O and a molecular weight of 382.39 g/mol. Its IUPAC name is 2-(5-isocyanobenzimidazol-1-yl)-9-(1-pyridin-3-ylethyl)-7H-purin-8-one.
| Compound Name | 2-(5-isocyanobenzimidazol-1-yl)-9-(1-pyridin-3-ylethyl)-7H-purin-8-one |
|---|---|
| PubChem CID | 59846493 |
| Molecular Formula | C20H14N8O |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 2-(5-isocyanobenzimidazol-1-yl)-9-(1-pyridin-3-ylethyl)-7H-purin-8-one |
| SMILES | [C-]#[N+]c1ccc2c(c1)ncn2-c1ncc2[nH]c(=O)n(C(C)c3cccnc3)c2n1 |
| InChI | InChI=1S/C20H14N8O/c1-12(13-4-3-7-22-9-13)28-18-16(25-20(28)29)10-23-19(26-18)27-11-24-15-8-14(21-2)5-6-17(15)27/h3-12H,1H3,(H,25,29) |
| InChIKey | AVRJAZLEXINAIX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|