C20H12ClN7O — CID 59846356
9-[(2-chlorophenyl)methyl]-2-(6-isocyanobenzimidazol-1-yl)-7H-purin-8-one (PubChem CID 59846356) has the molecular formula C20H12ClN7O and a molecular weight of 401.82 g/mol. Its IUPAC name is 9-[(2-chlorophenyl)methyl]-2-(6-isocyanobenzimidazol-1-yl)-7H-purin-8-one.
| Compound Name | 9-[(2-chlorophenyl)methyl]-2-(6-isocyanobenzimidazol-1-yl)-7H-purin-8-one |
|---|---|
| PubChem CID | 59846356 |
| Molecular Formula | C20H12ClN7O |
| Molecular Weight | 401.82 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 9-[(2-chlorophenyl)methyl]-2-(6-isocyanobenzimidazol-1-yl)-7H-purin-8-one |
| SMILES | [C-]#[N+]c1ccc2ncn(-c3ncc4[nH]c(=O)n(Cc5ccccc5Cl)c4n3)c2c1 |
| InChI | InChI=1S/C20H12ClN7O/c1-22-13-6-7-15-17(8-13)28(11-24-15)19-23-9-16-18(26-19)27(20(29)25-16)10-12-4-2-3-5-14(12)21/h2-9,11H,10H2,(H,25,29) |
| InChIKey | LRNRHZIOUIVXPZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.82 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|