C23H28N6O5S2 — CID 59847259
2-[[5-cyano-6-(cyclohexylamino)-2-(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]benzenesulfonic acid (PubChem CID 59847259) has the molecular formula C23H28N6O5S2 and a molecular weight of 532.65 g/mol. Its IUPAC name is 2-[[5-cyano-6-(cyclohexylamino)-2-(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]benzenesulfonic acid.
| Compound Name | 2-[[5-cyano-6-(cyclohexylamino)-2-(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 59847259 |
| Molecular Formula | C23H28N6O5S2 |
| Molecular Weight | 532.65 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | 2-[[5-cyano-6-(cyclohexylamino)-2-(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]benzenesulfonic acid |
| SMILES | C=CS(=O)(=O)CCNc1nc(NC2CCCCC2)c(C#N)c(C)c1/N=N/c1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C23H28N6O5S2/c1-3-35(30,31)14-13-25-23-21(29-28-19-11-7-8-12-20(19)36(32,33)34)16(2)18(15-24)22(27-23)26-17-9-5-4-6-10-17/h3,7-8,11-12,17H,1,4-6,9-10,13-14H2,2H3,(H2,25,26,27)(H,32,33,34)/b29-28+ |
| InChIKey | ZFDVCNROSLUGQW-ZQHSETAFSA-N |
| XLogP | 4.64 |
| TPSA | 173.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.65 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|