C35H32N6NaO8S3+ — CID 119057695
sodium 2-[2-[[3-[[2-(benzenesulfonyl)phenyl]diazenyl]-5-cyano-4-methyl-6-[2-(2-sulfophenyl)ethylamino]-2-pyridinyl]amino]ethyl]benzenesulfonic acid (PubChem CID 119057695) has the molecular formula C35H32N6NaO8S3+ and a molecular weight of 783.87 g/mol. Its IUPAC name is sodium 2-[2-[[3-[[2-(benzenesulfonyl)phenyl]diazenyl]-5-cyano-4-methyl-6-[2-(2-sulfophenyl)ethylamino]-2-pyridinyl]amino]ethyl]benzenesulfonic acid.
| Compound Name | sodium 2-[2-[[3-[[2-(benzenesulfonyl)phenyl]diazenyl]-5-cyano-4-methyl-6-[2-(2-sulfophenyl)ethylamino]-2-pyridinyl]amino]ethyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 119057695 |
| Molecular Formula | C35H32N6NaO8S3+ |
| Molecular Weight | 783.87 g/mol |
| Exact Mass | 783.13 |
| IUPAC Name | sodium 2-[2-[[3-[[2-(benzenesulfonyl)phenyl]diazenyl]-5-cyano-4-methyl-6-[2-(2-sulfophenyl)ethylamino]-2-pyridinyl]amino]ethyl]benzenesulfonic acid |
| SMILES | Cc1c(C#N)c(NCCc2ccccc2S(=O)(=O)O)nc(NCCc2ccccc2S(=O)(=O)O)c1/N=N/c1ccccc1S(=O)(=O)c1ccccc1.[Na+] |
| InChI | InChI=1S/C35H32N6O8S3.Na/c1-24-28(23-36)34(37-21-19-25-11-5-8-16-30(25)51(44,45)46)39-35(38-22-20-26-12-6-9-17-31(26)52(47,48)49)33(24)41-40-29-15-7-10-18-32(29)50(42,43)27-13-3-2-4-14-27;/h2-18H,19-22H2,1H3,(H2,37,38,39)(H,44,45,46)(H,47,48,49);/q;+1/b41-40+; |
| InChIKey | ZVYMIZDKMDEAAN-MSWFXQITSA-N |
| XLogP | 3.32 |
| TPSA | 228.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.87 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|