C21H26N6O5S2 — CID 59847260
2-[[6-(butylamino)-5-cyano-2-(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]benzenesulfonic acid (PubChem CID 59847260) has the molecular formula C21H26N6O5S2 and a molecular weight of 506.61 g/mol. Its IUPAC name is 2-[[6-(butylamino)-5-cyano-2-(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]benzenesulfonic acid.
| Compound Name | 2-[[6-(butylamino)-5-cyano-2-(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 59847260 |
| Molecular Formula | C21H26N6O5S2 |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | 2-[[6-(butylamino)-5-cyano-2-(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]benzenesulfonic acid |
| SMILES | C=CS(=O)(=O)CCNc1nc(NCCCC)c(C#N)c(C)c1/N=N/c1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C21H26N6O5S2/c1-4-6-11-23-20-16(14-22)15(3)19(21(25-20)24-12-13-33(28,29)5-2)27-26-17-9-7-8-10-18(17)34(30,31)32/h5,7-10H,2,4,6,11-13H2,1,3H3,(H2,23,24,25)(H,30,31,32)/b27-26+ |
| InChIKey | LDOBAWNUFTVWKI-CYYJNZCTSA-N |
| XLogP | 4.11 |
| TPSA | 173.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|