C13H20N4O10S3 — CID 59847316
2-[2-[[5-cyano-4-methyl-6-[2-(trioxidanylsulfanyloxy)ethylamino]-2-pyridinyl]amino]ethylsulfonyl]ethyl hydrogen sulfate (PubChem CID 59847316) has the molecular formula C13H20N4O10S3 and a molecular weight of 488.52 g/mol. Its IUPAC name is 2-[2-[[5-cyano-4-methyl-6-[2-(trioxidanylsulfanyloxy)ethylamino]-2-pyridinyl]amino]ethylsulfonyl]ethyl hydrogen sulfate.
| Compound Name | 2-[2-[[5-cyano-4-methyl-6-[2-(trioxidanylsulfanyloxy)ethylamino]-2-pyridinyl]amino]ethylsulfonyl]ethyl hydrogen sulfate |
|---|---|
| PubChem CID | 59847316 |
| Molecular Formula | C13H20N4O10S3 |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.03 |
| IUPAC Name | 2-[2-[[5-cyano-4-methyl-6-[2-(trioxidanylsulfanyloxy)ethylamino]-2-pyridinyl]amino]ethylsulfonyl]ethyl hydrogen sulfate |
| SMILES | Cc1cc(NCCS(=O)(=O)CCOS(=O)(=O)O)nc(NCCOSOOO)c1C#N |
| InChI | InChI=1S/C13H20N4O10S3/c1-10-8-12(15-3-6-29(19,20)7-5-25-30(21,22)23)17-13(11(10)9-14)16-2-4-24-28-27-26-18/h8,18H,2-7H2,1H3,(H2,15,16,17)(H,21,22,23) |
| InChIKey | SXEJOGFVOGMKMC-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 206.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|