C25H31N7O16S5 — CID 163736510
2-[[4,5-dimethyl-6-(2-sulfooxyethylamino)-2-[2-(2-sulfooxyethylsulfonyl)ethylamino]-3-pyridinyl]diazenyl]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid (PubChem CID 163736510) has the molecular formula C25H31N7O16S5 and a molecular weight of 845.89 g/mol. Its IUPAC name is 2-[[4,5-dimethyl-6-(2-sulfooxyethylamino)-2-[2-(2-sulfooxyethylsulfonyl)ethylamino]-3-pyridinyl]diazenyl]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid.
| Compound Name | 2-[[4,5-dimethyl-6-(2-sulfooxyethylamino)-2-[2-(2-sulfooxyethylsulfonyl)ethylamino]-3-pyridinyl]diazenyl]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 163736510 |
| Molecular Formula | C25H31N7O16S5 |
| Molecular Weight | 845.89 g/mol |
| Exact Mass | 845.04 |
| IUPAC Name | 2-[[4,5-dimethyl-6-(2-sulfooxyethylamino)-2-[2-(2-sulfooxyethylsulfonyl)ethylamino]-3-pyridinyl]diazenyl]-5-[(4-sulfophenyl)diazenyl]benzenesulfonic acid |
| SMILES | Cc1c(NCCOS(=O)(=O)O)nc(NCCS(=O)(=O)CCOS(=O)(=O)O)c(/N=N/c2ccc(/N=N/c3ccc(S(=O)(=O)O)cc3)cc2S(=O)(=O)O)c1C |
| InChI | InChI=1S/C25H31N7O16S5/c1-16-17(2)24(26-9-11-47-52(41,42)43)28-25(27-10-13-49(33,34)14-12-48-53(44,45)46)23(16)32-31-21-8-5-19(15-22(21)51(38,39)40)30-29-18-3-6-20(7-4-18)50(35,36)37/h3-8,15H,9-14H2,1-2H3,(H2,26,27,28)(H,35,36,37)(H,38,39,40)(H,41,42,43)(H,44,45,46)/b30-29+,32-31+ |
| InChIKey | LEBNFDMGRFMTQD-PNBBGTCESA-N |
| XLogP | 2.90 |
| TPSA | 356.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.89 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|