C32H25N7O12S4 — CID 159456882
2-[[5-cyano-4-methyl-2-(4-sulfoanilino)-6-[(4-sulfophenyl)methyl]-3-pyridinyl]diazenyl]-5-phenyldiazenylbenzenesulfonic acid;sulfur trioxide (PubChem CID 159456882) has the molecular formula C32H25N7O12S4 and a molecular weight of 827.86 g/mol. Its IUPAC name is 2-[[5-cyano-4-methyl-2-(4-sulfoanilino)-6-[(4-sulfophenyl)methyl]-3-pyridinyl]diazenyl]-5-phenyldiazenylbenzenesulfonic acid;sulfur trioxide.
| Compound Name | 2-[[5-cyano-4-methyl-2-(4-sulfoanilino)-6-[(4-sulfophenyl)methyl]-3-pyridinyl]diazenyl]-5-phenyldiazenylbenzenesulfonic acid;sulfur trioxide |
|---|---|
| PubChem CID | 159456882 |
| Molecular Formula | C32H25N7O12S4 |
| Molecular Weight | 827.86 g/mol |
| Exact Mass | 827.04 |
| IUPAC Name | 2-[[5-cyano-4-methyl-2-(4-sulfoanilino)-6-[(4-sulfophenyl)methyl]-3-pyridinyl]diazenyl]-5-phenyldiazenylbenzenesulfonic acid;sulfur trioxide |
| SMILES | Cc1c(C#N)c(Cc2ccc(S(=O)(=O)O)cc2)nc(Nc2ccc(S(=O)(=O)O)cc2)c1/N=N/c1ccc(/N=N/c2ccccc2)cc1S(=O)(=O)O.O=S(=O)=O |
| InChI | InChI=1S/C32H25N7O9S3.O3S/c1-20-27(19-33)29(17-21-7-12-25(13-8-21)49(40,41)42)35-32(34-22-9-14-26(15-10-22)50(43,44)45)31(20)39-38-28-16-11-24(18-30(28)51(46,47)48)37-36-23-5-3-2-4-6-23;1-4(2)3/h2-16,18H,17H2,1H3,(H,34,35)(H,40,41,42)(H,43,44,45)(H,46,47,48);/b37-36+,39-38+; |
| InChIKey | LUBWYOFNZOLDDJ-DIWDKPPBSA-N |
| XLogP | 6.16 |
| TPSA | 312.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.86 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|