C30H30N8O4S — CID 165366415
3-[[4-[[6-(benzylamino)-5-cyano-2-(2-hydroxyethylamino)-4-methyl-3-pyridinyl]diazenyl]-2,5-dimethylphenyl]diazenyl]benzenesulfonic acid (PubChem CID 165366415) has the molecular formula C30H30N8O4S and a molecular weight of 598.69 g/mol. Its IUPAC name is 3-[[4-[[6-(benzylamino)-5-cyano-2-(2-hydroxyethylamino)-4-methyl-3-pyridinyl]diazenyl]-2,5-dimethylphenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 3-[[4-[[6-(benzylamino)-5-cyano-2-(2-hydroxyethylamino)-4-methyl-3-pyridinyl]diazenyl]-2,5-dimethylphenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 165366415 |
| Molecular Formula | C30H30N8O4S |
| Molecular Weight | 598.69 g/mol |
| Exact Mass | 598.21 |
| IUPAC Name | 3-[[4-[[6-(benzylamino)-5-cyano-2-(2-hydroxyethylamino)-4-methyl-3-pyridinyl]diazenyl]-2,5-dimethylphenyl]diazenyl]benzenesulfonic acid |
| SMILES | Cc1cc(/N=N/c2c(NCCO)nc(NCc3ccccc3)c(C#N)c2C)c(C)cc1/N=N/c1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C30H30N8O4S/c1-19-15-27(20(2)14-26(19)36-35-23-10-7-11-24(16-23)43(40,41)42)37-38-28-21(3)25(17-31)29(34-30(28)32-12-13-39)33-18-22-8-5-4-6-9-22/h4-11,14-16,39H,12-13,18H2,1-3H3,(H2,32,33,34)(H,40,41,42)/b36-35+,38-37+ |
| InChIKey | PQFRVMNSGBXGJR-JKWOPUAESA-N |
| XLogP | 6.97 |
| TPSA | 184.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.69 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|