C25H28N6O8S3 — CID 89226310
4-[[6-(butylamino)-5-cyano-2-(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]naphthalene-1,3-disulfonic acid (PubChem CID 89226310) has the molecular formula C25H28N6O8S3 and a molecular weight of 636.73 g/mol. Its IUPAC name is 4-[[6-(butylamino)-5-cyano-2-(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]naphthalene-1,3-disulfonic acid.
| Compound Name | 4-[[6-(butylamino)-5-cyano-2-(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]naphthalene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 89226310 |
| Molecular Formula | C25H28N6O8S3 |
| Molecular Weight | 636.73 g/mol |
| Exact Mass | 636.11 |
| IUPAC Name | 4-[[6-(butylamino)-5-cyano-2-(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]naphthalene-1,3-disulfonic acid |
| SMILES | C=CS(=O)(=O)CCNc1nc(NCCCC)c(C#N)c(C)c1/N=N/c1c(S(=O)(=O)O)cc(S(=O)(=O)O)c2ccccc12 |
| InChI | InChI=1S/C25H28N6O8S3/c1-4-6-11-27-24-19(15-26)16(3)22(25(29-24)28-12-13-40(32,33)5-2)30-31-23-18-10-8-7-9-17(18)20(41(34,35)36)14-21(23)42(37,38)39/h5,7-10,14H,2,4,6,11-13H2,1,3H3,(H2,27,28,29)(H,34,35,36)(H,37,38,39)/b31-30+ |
| InChIKey | PZWLLBNQLPEART-NVQSTNCTSA-N |
| XLogP | 4.51 |
| TPSA | 228.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.73 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|