C25H28N6O5S2 — CID 89226465
4-[[2-(butylamino)-5-cyano-6-(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]naphthalene-1-sulfonic acid (PubChem CID 89226465) has the molecular formula C25H28N6O5S2 and a molecular weight of 556.67 g/mol. Its IUPAC name is 4-[[2-(butylamino)-5-cyano-6-(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]naphthalene-1-sulfonic acid.
| Compound Name | 4-[[2-(butylamino)-5-cyano-6-(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 89226465 |
| Molecular Formula | C25H28N6O5S2 |
| Molecular Weight | 556.67 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | 4-[[2-(butylamino)-5-cyano-6-(2-ethenylsulfonylethylamino)-4-methyl-3-pyridinyl]diazenyl]naphthalene-1-sulfonic acid |
| SMILES | C=CS(=O)(=O)CCNc1nc(NCCCC)c(/N=N/c2ccc(S(=O)(=O)O)c3ccccc23)c(C)c1C#N |
| InChI | InChI=1S/C25H28N6O5S2/c1-4-6-13-27-25-23(17(3)20(16-26)24(29-25)28-14-15-37(32,33)5-2)31-30-21-11-12-22(38(34,35)36)19-10-8-7-9-18(19)21/h5,7-12H,2,4,6,13-15H2,1,3H3,(H2,27,28,29)(H,34,35,36)/b31-30+ |
| InChIKey | YCJHZCXOEPWWRM-NVQSTNCTSA-N |
| XLogP | 5.26 |
| TPSA | 173.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.67 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|