C29H36N8O5S — CID 140626243
3-[[4-[[5-cyano-2,6-bis(3-methoxypropylamino)-4-methyl-3-pyridinyl]diazenyl]-2,5-dimethylphenyl]diazenyl]benzenesulfonic acid (PubChem CID 140626243) has the molecular formula C29H36N8O5S and a molecular weight of 608.73 g/mol. Its IUPAC name is 3-[[4-[[5-cyano-2,6-bis(3-methoxypropylamino)-4-methyl-3-pyridinyl]diazenyl]-2,5-dimethylphenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 3-[[4-[[5-cyano-2,6-bis(3-methoxypropylamino)-4-methyl-3-pyridinyl]diazenyl]-2,5-dimethylphenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 140626243 |
| Molecular Formula | C29H36N8O5S |
| Molecular Weight | 608.73 g/mol |
| Exact Mass | 608.25 |
| IUPAC Name | 3-[[4-[[5-cyano-2,6-bis(3-methoxypropylamino)-4-methyl-3-pyridinyl]diazenyl]-2,5-dimethylphenyl]diazenyl]benzenesulfonic acid |
| SMILES | COCCCNc1nc(NCCCOC)c(/N=N/c2cc(C)c(/N=N/c3cccc(S(=O)(=O)O)c3)cc2C)c(C)c1C#N |
| InChI | InChI=1S/C29H36N8O5S/c1-19-16-26(20(2)15-25(19)35-34-22-9-6-10-23(17-22)43(38,39)40)36-37-27-21(3)24(18-30)28(31-11-7-13-41-4)33-29(27)32-12-8-14-42-5/h6,9-10,15-17H,7-8,11-14H2,1-5H3,(H2,31,32,33)(H,38,39,40)/b35-34+,37-36+ |
| InChIKey | VMABFISZBDSNMX-XGMUGIETSA-N |
| XLogP | 6.85 |
| TPSA | 183.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.73 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|